CAS 937626-14-7 is the registry number for 3-(3-(3-Chloro-4,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[3-(3-chloro-4,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 937626-14-7) is a chemical compound with the molecular formula C13H13ClN2O5 and a molecular weight of 312.70 g/mol. IUPAC name: 3-[3-(3-chloro-4,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: VXNRWUNQNXYINM-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O5 |
|---|---|
| Molecular weight | 312.70 g/mol |
| IUPAC name | 3-[3-(3-chloro-4,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | VXNRWUNQNXYINM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C2=NOC(=N2)CCC(=O)O)Cl)OC |
Computed by PubChem (NCBI)