CAS 937663-35-9 is the registry number for Sodium 5-tert-butyl-4-methyl-1,3-thiazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Sodium 5-tert-butyl-4-methyl-1,3-thiazole-2-carboxylate (CAS 937663-35-9) is a chemical compound with the molecular formula C9H12NNaO2S and a molecular weight of 221.25 g/mol. IUPAC name: sodium 5-tert-butyl-4-methyl-1,3-thiazole-2-carboxylate. InChIKey: QBETVZPXNUJHSR-UHFFFAOYSA-M.
| Molecular formula | C9H12NNaO2S |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | sodium 5-tert-butyl-4-methyl-1,3-thiazole-2-carboxylate |
| InChIKey | QBETVZPXNUJHSR-UHFFFAOYSA-M |
| SMILES | CC1=C(SC(=N1)C(=O)[O-])C(C)(C)C.[Na+] |
Computed by PubChem (NCBI)