CAS 937666-06-3 appears in our catalog under these names: 1-{3-(4-(propan-2-yl)phenyl)-1,2,4-oxadiazol-5-yl}ethan-1-amine, 95%, 1-{3-(4-(Propan-2-yl)phenyl)-1,2,4-oxadiazol-5-yl}ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine (CAS 937666-06-3) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 1-[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine. InChIKey: KVLHGMLYZICNNW-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| InChIKey | KVLHGMLYZICNNW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NOC(=N2)C(C)N |
Computed by PubChem (NCBI)