Products 93768-40-2
CAS 93768-40-2 is the registry number for 1,6-Dihydroxy-2-chlorophenazine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chlorophenazine-1,6-diol (CAS 93768-40-2) is a chemical compound with the molecular formula C12H7ClN2O2 and a molecular weight of 246.65 g/mol. IUPAC name: 2-chlorophenazine-1,6-diol. InChIKey: PFRLSIGYPXAHNU-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O2 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 2-chlorophenazine-1,6-diol |
| InChIKey | PFRLSIGYPXAHNU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)N=C3C=CC(=C(C3=N2)O)Cl |
Computed by PubChem (NCBI)