CAS 937682-00-3 appears in our catalog under these names: 4-Isopropyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine, 95%, 4-Isopropyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)thiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-(3-phenyl-1,2,4-oxadiazol-5-yl)-4-propan-2-yl-1,3-thiazol-2-amine (CAS 937682-00-3) is a chemical compound with the molecular formula C14H14N4OS and a molecular weight of 286.35 g/mol. IUPAC name: 5-(3-phenyl-1,2,4-oxadiazol-5-yl)-4-propan-2-yl-1,3-thiazol-2-amine. InChIKey: KPYGCRUQYWOEBV-UHFFFAOYSA-N.
| Molecular formula | C14H14N4OS |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | 5-(3-phenyl-1,2,4-oxadiazol-5-yl)-4-propan-2-yl-1,3-thiazol-2-amine |
| InChIKey | KPYGCRUQYWOEBV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(SC(=N1)N)C2=NC(=NO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)