Products 93783-15-4

CAS 93783-15-4 appears in our catalog under these names: 3,3-Dichloro-2-oxoindoline-5-sulfonyl chloride, 95%, 3,3-Dichloro-2-oxoindoline-5-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.

Structural formula: {0} (CAS {1})

3,3-dichloro-2-oxo-1H-indole-5-sulfonyl chloride (CAS 93783-15-4) is a chemical compound with the molecular formula C8H4Cl3NO3S and a molecular weight of 300.5 g/mol. IUPAC name: 3,3-dichloro-2-oxo-1H-indole-5-sulfonyl chloride. InChIKey: XXQVRYBFEWKZBM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl3NO3S
Molecular weight300.5 g/mol
IUPAC name3,3-dichloro-2-oxo-1H-indole-5-sulfonyl chloride
InChIKeyXXQVRYBFEWKZBM-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1S(=O)(=O)Cl)C(C(=O)N2)(Cl)Cl

Computed by PubChem (NCBI)