CAS 938071-78-4 is the registry number for (E)-1-(4-(4-(2-Methylbut-2-en-1-yl)piperazin-1-yl)phenyl)ethanone Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.
1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone;hydrochloride (CAS 938071-78-4) is a chemical compound with the molecular formula C17H25ClN2O and a molecular weight of 308.8 g/mol. IUPAC name: 1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone;hydrochloride. InChIKey: JXMXRDRWDJFHHU-BIZGWHPPSA-N.
| Molecular formula | C17H25ClN2O |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone;hydrochloride |
| InChIKey | JXMXRDRWDJFHHU-BIZGWHPPSA-N |
| SMILES | C/C=C(\C)/CN1CCN(CC1)C2=CC=C(C=C2)C(=O)C.Cl |
Computed by PubChem (NCBI)