CAS 938156-72-0 is the registry number for 2-((2,4-dichlorobenzyl)thio)-4,5-dihydro-1H-imidazole hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 938156-72-0) is a chemical compound with the molecular formula C10H11Cl3N2S and a molecular weight of 297.6 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: RGQBQUASBOMYTQ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl3N2S |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | RGQBQUASBOMYTQ-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)SCC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)