CAS 938278-28-5 appears in our catalog under these names: 3-{5-chloro-2-((4-fluorophenyl)methoxy)phenyl}prop-2-enoic acid, 95%, (2E)-3-{5-Chloro-2-((4-fluorophenyl)methoxy)phenyl}prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(E)-3-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid (CAS 938278-28-5) is a chemical compound with the molecular formula C16H12ClFO3 and a molecular weight of 306.71 g/mol. IUPAC name: (E)-3-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid. InChIKey: ZWZJPAXAXHPLPG-FPYGCLRLSA-N.
| Molecular formula | C16H12ClFO3 |
|---|---|
| Molecular weight | 306.71 g/mol |
| IUPAC name | (E)-3-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid |
| InChIKey | ZWZJPAXAXHPLPG-FPYGCLRLSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C=C2)Cl)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)