Products 938458-90-3
CAS 938458-90-3 is the registry number for 2-Amino-6-isobutylpyrimidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-amino-6-(2-methylpropyl)pyrimidine-4-carboxylic acid (CAS 938458-90-3) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: 2-amino-6-(2-methylpropyl)pyrimidine-4-carboxylic acid. InChIKey: WHKPTEJDEXIZAF-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-amino-6-(2-methylpropyl)pyrimidine-4-carboxylic acid |
| InChIKey | WHKPTEJDEXIZAF-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=NC(=N1)N)C(=O)O |
Computed by PubChem (NCBI)