Products 93905-59-0

CAS 93905-59-0 is the registry number for 3-Hydroxy-2-oxo-2H-pyran-6-carboxylic acid, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-hydroxy-6-oxopyran-2-carboxylic acid (CAS 93905-59-0) is a chemical compound with the molecular formula C6H4O5 and a molecular weight of 156.09 g/mol. IUPAC name: 5-hydroxy-6-oxopyran-2-carboxylic acid. InChIKey: FRBVENQEOYXRBR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4O5
Molecular weight156.09 g/mol
IUPAC name5-hydroxy-6-oxopyran-2-carboxylic acid
InChIKeyFRBVENQEOYXRBR-UHFFFAOYSA-N
SMILESC1=C(C(=O)OC(=C1)C(=O)O)O

Computed by PubChem (NCBI)