CAS 939050-79-0 is the registry number for Ethyl 3-chloro-4-(((trifluoromethyl)sulfonyl)oxy)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-chloro-4-(trifluoromethylsulfonyloxy)benzoate (CAS 939050-79-0) is a chemical compound with the molecular formula C10H8ClF3O5S and a molecular weight of 332.68 g/mol. IUPAC name: ethyl 3-chloro-4-(trifluoromethylsulfonyloxy)benzoate. InChIKey: ZAVRKTDPUMWMST-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O5S |
|---|---|
| Molecular weight | 332.68 g/mol |
| IUPAC name | ethyl 3-chloro-4-(trifluoromethylsulfonyloxy)benzoate |
| InChIKey | ZAVRKTDPUMWMST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)OS(=O)(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)