CAS 93914-28-4 appears in our catalog under these names: Sodium Gualenate Impurity 4, Sodium Gualenate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 1,4-dimethyl-7-propan-2-ylazulene-2-sulfonate (CAS 93914-28-4) is a chemical compound with the molecular formula C15H17NaO3S and a molecular weight of 300.4 g/mol. IUPAC name: sodium 1,4-dimethyl-7-propan-2-ylazulene-2-sulfonate. InChIKey: JAYXWOQYHQJQNA-UHFFFAOYSA-M.
| Molecular formula | C15H17NaO3S |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | sodium 1,4-dimethyl-7-propan-2-ylazulene-2-sulfonate |
| InChIKey | JAYXWOQYHQJQNA-UHFFFAOYSA-M |
| SMILES | CC1=C2C=C(C(=C2C=C(C=C1)C(C)C)C)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)