CAS 939375-07-2 appears in our catalog under these names: DGAT1-IN-3, 98%, DGAT1–IN–3, DGAT1-IN-3, DGAT1-IN-3, 99.92%, 99.92%, DGAT1-IN-3, 99.92%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 25mg, 1mg, 10 mg, 5 mg.
N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (CAS 939375-07-2) is a chemical compound with the molecular formula C20H19F3N4O3 and a molecular weight of 420.4 g/mol. IUPAC name: N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide. InChIKey: QEZWDFXCTTZZRI-UHFFFAOYSA-N.
| Molecular formula | C20H19F3N4O3 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| InChIKey | QEZWDFXCTTZZRI-UHFFFAOYSA-N |
| SMILES | CN(CCOC)C1=NC=C(C=C1)NC(=O)C2=C(OC(=N2)C3=CC=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)