CAS 939411-25-3 is the registry number for (4R)-6-Fluoro-3,4-dihydrospiro(1-benzopyran-2,1'-cyclopentane)-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol (CAS 939411-25-3) is a chemical compound with the molecular formula C13H15FO2 and a molecular weight of 222.25 g/mol. IUPAC name: (4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol. InChIKey: CQDHJWCLXIQJNV-LLVKDONJSA-N.
| Molecular formula | C13H15FO2 |
|---|---|
| Molecular weight | 222.25 g/mol |
| IUPAC name | (4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol |
| InChIKey | CQDHJWCLXIQJNV-LLVKDONJSA-N |
| SMILES | C1CCC2(C1)C[C@H](C3=C(O2)C=CC(=C3)F)O |
Computed by PubChem (NCBI)