CAS 93951-75-8 appears in our catalog under these names: 2,4-Dimethylphenol D3 (3,5,6 D3), 2,4-Dimethylphenol D3 (3,5,6 D3) 100 µg/mL in Acetone, 2,4-Dimethylphenol-3,5,6-d3, 98 atom % D, min 98% Chemical Purity, 2,4-DIMETHYLPHENOL-3,5,6-D3, 98 ATOM% D. Offered by: Dr. Ehrenstorfer, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1ml, 0,5g, 0,25g, 250MG.
2,3,5-trideuterio-4,6-dimethylphenol (CAS 93951-75-8) is a chemical compound with the molecular formula C8H10O and a molecular weight of 125.18 g/mol. IUPAC name: 2,3,5-trideuterio-4,6-dimethylphenol. InChIKey: KUFFULVDNCHOFZ-QGZYMEECSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 125.18 g/mol |
| IUPAC name | 2,3,5-trideuterio-4,6-dimethylphenol |
| InChIKey | KUFFULVDNCHOFZ-QGZYMEECSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])C)O)[2H] |
Computed by PubChem (NCBI)