CAS 93951-84-9 appears in our catalog under these names: 2-Chloronaphthalene-d7, 2-Chloronaphthalene-d7, 98 atom % D, min 98% Chemical Purity, 2–Chloronaphthalene–d7, 2-Chloronaphthalene-d7, 98.93%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene (CAS 93951-84-9) is a chemical compound with the molecular formula C10H7Cl and a molecular weight of 169.66 g/mol. IUPAC name: 2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene. InChIKey: CGYGETOMCSJHJU-GSNKEKJESA-N.
| Molecular formula | C10H7Cl |
|---|---|
| Molecular weight | 169.66 g/mol |
| IUPAC name | 2-chloro-1,3,4,5,6,7,8-heptadeuterionaphthalene |
| InChIKey | CGYGETOMCSJHJU-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])Cl)[2H])[2H])[2H] |
Computed by PubChem (NCBI)