CAS 93951-94-1 appears in our catalog under these names: 2–Naphthalen–1,3,4,5,6,7,8–d7–amine, 2-Aminonaphthalene-d7, 2-Naphthylamine-d7, >95% (HPLC), 2-Aminonaphthalene D7 100 µg/mL in Methanol, 2-Aminonaphthalene-d7, 99 atom % D, min 98% Chemical Purity. Offered by: GLPBio, Chemat Brand, TRC, Dr. Ehrenstorfer, CDN. Available pack sizes: 1mg, on request, 50mg, 5mg, 1ml, 0,1g, 0,05g, 10mg.
1,3,4,5,6,7,8-heptadeuterionaphthalen-2-amine (CAS 93951-94-1) is a chemical compound with the molecular formula C10H9N and a molecular weight of 150.23 g/mol. IUPAC name: 1,3,4,5,6,7,8-heptadeuterionaphthalen-2-amine. InChIKey: JBIJLHTVPXGSAM-GSNKEKJESA-N.
| Molecular formula | C10H9N |
|---|---|
| Molecular weight | 150.23 g/mol |
| IUPAC name | 1,3,4,5,6,7,8-heptadeuterionaphthalen-2-amine |
| InChIKey | JBIJLHTVPXGSAM-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])N)[2H])[2H])[2H] |
Computed by PubChem (NCBI)