CAS 93952-02-4 is the registry number for Bis(2-chloroethyl)-d8 Ether, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
1-chloro-2-(2-chloro-1,1,2,2-tetradeuterioethoxy)-1,1,2,2-tetradeuterioethane (CAS 93952-02-4) is a chemical compound with the molecular formula C4H8Cl2O and a molecular weight of 151.06 g/mol. IUPAC name: 1-chloro-2-(2-chloro-1,1,2,2-tetradeuterioethoxy)-1,1,2,2-tetradeuterioethane. InChIKey: ZNSMNVMLTJELDZ-SVYQBANQSA-N.
| Molecular formula | C4H8Cl2O |
|---|---|
| Molecular weight | 151.06 g/mol |
| IUPAC name | 1-chloro-2-(2-chloro-1,1,2,2-tetradeuterioethoxy)-1,1,2,2-tetradeuterioethane |
| InChIKey | ZNSMNVMLTJELDZ-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)OC([2H])([2H])C([2H])([2H])Cl |
Computed by PubChem (NCBI)