CAS 93952-08-0 appears in our catalog under these names: 1,2-Dichloropropane-d6, (±)-1,2-Dichloropropane-d6, 98 atom % D, min 98% Chemical Purity, 1,2–Dichloropropane–d6. Offered by: TRC, CDN, GLPBio. Available pack sizes: 0,5mg, 1mg, 5mg, 0,5g, 0,25g, 50mg.
1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane (CAS 93952-08-0) is a chemical compound with the molecular formula C3H6Cl2 and a molecular weight of 119.02 g/mol. IUPAC name: 1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane. InChIKey: KNKRKFALVUDBJE-LIDOUZCJSA-N.
| Molecular formula | C3H6Cl2 |
|---|---|
| Molecular weight | 119.02 g/mol |
| IUPAC name | 1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane |
| InChIKey | KNKRKFALVUDBJE-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)Cl |
Computed by PubChem (NCBI)