CAS 93957-53-0 is the registry number for Fluvastatin Methyl Ester. Offered by: TRC, Mikromol. Available pack sizes: 100mg, 1g, 4x25mg, 25mg.
Methyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (CAS 93957-53-0) is a chemical compound with the molecular formula C25H28FNO4 and a molecular weight of 425.5 g/mol. IUPAC name: methyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate. InChIKey: BOCZYIUKFAQNLG-DSJWGCTQSA-N.
| Molecular formula | C25H28FNO4 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | methyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| InChIKey | BOCZYIUKFAQNLG-DSJWGCTQSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/[C@@H](C[C@@H](CC(=O)OC)O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)