CAS 93971-54-1 is the registry number for Ethanone, 1-[4-(1,1-dimethylethyl)phenyl]-, oxime, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine (CAS 93971-54-1) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: N-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine. InChIKey: SBTRCSJNYODJPM-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | N-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine |
| InChIKey | SBTRCSJNYODJPM-UHFFFAOYSA-N |
| SMILES | CC(=NO)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)