Products 93971-54-1

CAS 93971-54-1 is the registry number for Ethanone, 1-[4-(1,1-dimethylethyl)phenyl]-, oxime, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

N-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine (CAS 93971-54-1) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: N-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine. InChIKey: SBTRCSJNYODJPM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO
Molecular weight191.27 g/mol
IUPAC nameN-[1-(4-tert-butylphenyl)ethylidene]hydroxylamine
InChIKeySBTRCSJNYODJPM-UHFFFAOYSA-N
SMILESCC(=NO)C1=CC=C(C=C1)C(C)(C)C

Computed by PubChem (NCBI)