CAS 939768-65-7 appears in our catalog under these names: Jpmtwopharm jpm2-00-6994, 95%, (1s,3s)–tert–butyl 3–(tosyloxy)cyclobutanecarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
Tert-butyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate (CAS 939768-65-7) is a chemical compound with the molecular formula C16H22O5S and a molecular weight of 326.4 g/mol. IUPAC name: tert-butyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate. InChIKey: XRAKRCWHGGQELJ-UHFFFAOYSA-N.
| Molecular formula | C16H22O5S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | tert-butyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate |
| InChIKey | XRAKRCWHGGQELJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)