CAS 939793-21-2 appears in our catalog under these names: 7-Boc-1,7-diaza-spiro[4.5]decane, 95%, 1,7-Diazaspiro(4.5)decane-7-carboxylic acid tert-butyl ester, tert-Butyl 1,7-diazaspiro[4.5]decane-7-carboxylate, 97%, 97%, 7-BOC-1,7-DIAZA-SPIRO[4.5]DECANE, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 0,5g, 10g, 25g.
Tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate (CAS 939793-21-2) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate. InChIKey: PDFULYHFVRJQJO-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate |
| InChIKey | PDFULYHFVRJQJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCCN2 |
Computed by PubChem (NCBI)