CAS 93980-76-8 is the registry number for N-D-Gluconoyl-L-glutamic Acid. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentanedioic acid (CAS 93980-76-8) is a chemical compound with the molecular formula C11H19NO10 and a molecular weight of 325.27 g/mol. IUPAC name: (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentanedioic acid. InChIKey: RALMEYHIPGGEHB-MLBSCHOTSA-N.
| Molecular formula | C11H19NO10 |
|---|---|
| Molecular weight | 325.27 g/mol |
| IUPAC name | (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentanedioic acid |
| InChIKey | RALMEYHIPGGEHB-MLBSCHOTSA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)NC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)