CAS 93982-56-0 is the registry number for 2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethanone. Offered by: TRC. Available pack sizes: 1g.
2-hydroxy-1,2-bis(3-phenoxyphenyl)ethanone (CAS 93982-56-0) is a chemical compound with the molecular formula C26H20O4 and a molecular weight of 396.4 g/mol. IUPAC name: 2-hydroxy-1,2-bis(3-phenoxyphenyl)ethanone. InChIKey: DDDGBXZGYPJRKI-UHFFFAOYSA-N.
| Molecular formula | C26H20O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(3-phenoxyphenyl)ethanone |
| InChIKey | DDDGBXZGYPJRKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C(=O)C3=CC(=CC=C3)OC4=CC=CC=C4)O |
Computed by PubChem (NCBI)