CAS 94-52-0 appears in our catalog under these names: 5-Nitrobenzimidazole, 6–Nitrobenzimidazole, 5-Nitrobenzimidazole, 98+% , 5-Nitrobenzimidazole, >98.0%(GC)(T), 5-Nitrobenzimidizole. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 10mg, 100g, 500g, 50g, 250g, 25g, 1000g.
6-nitro-1H-benzimidazole (CAS 94-52-0) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 6-nitro-1H-benzimidazole. InChIKey: XPAZGLFMMUODDK-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 6-nitro-1H-benzimidazole |
| InChIKey | XPAZGLFMMUODDK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=N2 |
Computed by PubChem (NCBI)