CAS 940-06-7 appears in our catalog under these names: Nicotinic Acid EP Impurity I, 3,5-Dinitropyridine, >95% (HPLC), 3,5-Dinitropyridine, 98%. Offered by: Chemat Brand, TRC, Mikromol, Fluorochem. Available pack sizes: on request, 100mg, 25mg.
3,5-dinitropyridine (CAS 940-06-7) is a chemical compound with the molecular formula C5H3N3O4 and a molecular weight of 169.10 g/mol. IUPAC name: 3,5-dinitropyridine. InChIKey: RFSIFTKIXZLPHR-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O4 |
|---|---|
| Molecular weight | 169.10 g/mol |
| IUPAC name | 3,5-dinitropyridine |
| InChIKey | RFSIFTKIXZLPHR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)