CAS 940389-33-3 is the registry number for 2-(3-Bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridine (CAS 940389-33-3) is a chemical compound with the molecular formula C13H7BrCl2N2 and a molecular weight of 342.0 g/mol. IUPAC name: 2-(3-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridine. InChIKey: DBELGDBTBHHRBF-UHFFFAOYSA-N.
| Molecular formula | C13H7BrCl2N2 |
|---|---|
| Molecular weight | 342.0 g/mol |
| IUPAC name | 2-(3-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridine |
| InChIKey | DBELGDBTBHHRBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CN3C=C(C=C(C3=N2)Cl)Cl |
Computed by PubChem (NCBI)