Products 94059-38-8
CAS 94059-38-8 appears in our catalog under these names: 3′-Azido-2′,3′-dideoxy-GTP, 3'-Azido-2'3'-ddGTP, ≥95 %, 10 µl, plastic, 3'-Azido-2'3'-ddGTP, ≥95 %, 50 µl, plastic. Offered by: MedChemExpress, Roth. Available pack sizes: Get quote, 10µl, 50µl.
[[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 94059-38-8) is a chemical compound with the molecular formula C10H15N8O12P3 and a molecular weight of 532.19 g/mol. IUPAC name: [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: JZBFFCANYXZLES-KVQBGUIXSA-N.
| Molecular formula | C10H15N8O12P3 |
|---|---|
| Molecular weight | 532.19 g/mol |
| IUPAC name | [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | JZBFFCANYXZLES-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)