CAS 940814-14-2 is the registry number for 2-((3-Cyano-6-(trifluoromethyl)pyridin-2-yl)thio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (CAS 940814-14-2) is a chemical compound with the molecular formula C9H6F3N3OS and a molecular weight of 261.23 g/mol. IUPAC name: 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide. InChIKey: FUKYUDVFAVZJGF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3OS |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| InChIKey | FUKYUDVFAVZJGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C#N)SCC(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)