CAS 940881-02-7 is the registry number for [(3,3,3-Trifluoro-1-propen-1-yl)thio]toluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-methyl-4-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene (CAS 940881-02-7) is a chemical compound with the molecular formula C10H9F3S and a molecular weight of 218.24 g/mol. IUPAC name: 1-methyl-4-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene. InChIKey: XUOIOTQFOOCXAQ-VOTSOKGWSA-N.
| Molecular formula | C10H9F3S |
|---|---|
| Molecular weight | 218.24 g/mol |
| IUPAC name | 1-methyl-4-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
| InChIKey | XUOIOTQFOOCXAQ-VOTSOKGWSA-N |
| SMILES | CC1=CC=C(C=C1)S/C=C/C(F)(F)F |
Computed by PubChem (NCBI)