Products 941186-50-1
CAS 941186-50-1 is the registry number for 5-Bromo-2-fluoro-N-(pyridin-2-ylmethyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-fluoro-N-(pyridin-2-ylmethyl)benzamide (CAS 941186-50-1) is a chemical compound with the molecular formula C13H10BrFN2O and a molecular weight of 309.13 g/mol. IUPAC name: 5-bromo-2-fluoro-N-(pyridin-2-ylmethyl)benzamide. InChIKey: QZVFQXXSLHQROA-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2O |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N-(pyridin-2-ylmethyl)benzamide |
| InChIKey | QZVFQXXSLHQROA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)