CAS 941189-17-9 is the registry number for 3-methylphenyl 4-(5-(trifluoromethyl)(2-pyridyl))piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(3-methylphenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (CAS 941189-17-9) is a chemical compound with the molecular formula C18H18F3N3O and a molecular weight of 349.3 g/mol. IUPAC name: (3-methylphenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone. InChIKey: SBWQWRIXBWJMFK-UHFFFAOYSA-N.
| Molecular formula | C18H18F3N3O |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | (3-methylphenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| InChIKey | SBWQWRIXBWJMFK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)N2CCN(CC2)C3=NC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)