CAS 941294-15-1 is the registry number for Dimethyl 2-(5-methyl-2,4-dinitrophenyl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2-(5-methyl-2,4-dinitrophenyl)propanedioate (CAS 941294-15-1) is a chemical compound with the molecular formula C12H12N2O8 and a molecular weight of 312.23 g/mol. IUPAC name: dimethyl 2-(5-methyl-2,4-dinitrophenyl)propanedioate. InChIKey: RYAWZUFEAJRVCR-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O8 |
|---|---|
| Molecular weight | 312.23 g/mol |
| IUPAC name | dimethyl 2-(5-methyl-2,4-dinitrophenyl)propanedioate |
| InChIKey | RYAWZUFEAJRVCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)