CAS 941294-24-2 is the registry number for Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate (CAS 941294-24-2) is a chemical compound with the molecular formula C8H5Br2ClO3 and a molecular weight of 344.38 g/mol. IUPAC name: methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate. InChIKey: GZRLWDKMFBMBDE-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO3 |
|---|---|
| Molecular weight | 344.38 g/mol |
| IUPAC name | methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate |
| InChIKey | GZRLWDKMFBMBDE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1O)Br)Cl)Br |
Computed by PubChem (NCBI)