Products 941294-24-2

CAS 941294-24-2 is the registry number for Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate (CAS 941294-24-2) is a chemical compound with the molecular formula C8H5Br2ClO3 and a molecular weight of 344.38 g/mol. IUPAC name: methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate. InChIKey: GZRLWDKMFBMBDE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Br2ClO3
Molecular weight344.38 g/mol
IUPAC namemethyl 3,5-dibromo-4-chloro-2-hydroxybenzoate
InChIKeyGZRLWDKMFBMBDE-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1O)Br)Cl)Br

Computed by PubChem (NCBI)