CAS 941455-76-1 is the registry number for N-Ethyl-3-pivalamidobenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,2-dimethylpropanoylamino)-N-ethylbenzamide (CAS 941455-76-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: 3-(2,2-dimethylpropanoylamino)-N-ethylbenzamide. InChIKey: LRPSBFOHMFROHM-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 3-(2,2-dimethylpropanoylamino)-N-ethylbenzamide |
| InChIKey | LRPSBFOHMFROHM-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=CC=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)