CAS 941575-71-9 appears in our catalog under these names: 3-(5-Bromo-1-methyl-1H-indol-3-yl)-4-(benzofuran-3-yl)pyrrole-2,5-dione, BIP-135/ 99.77% (existing batch purity), BIP–135, BIP-135 99%, 3-(Benzofuran-3-yl)-4-(5-bromo-1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 500mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(1-benzofuran-3-yl)-4-(5-bromo-1-methylindol-3-yl)pyrrole-2,5-dione (CAS 941575-71-9) is a chemical compound with the molecular formula C21H13BrN2O3 and a molecular weight of 421.2 g/mol. IUPAC name: 3-(1-benzofuran-3-yl)-4-(5-bromo-1-methylindol-3-yl)pyrrole-2,5-dione. InChIKey: QKQJCKAXFJBYKJ-UHFFFAOYSA-N.
| Molecular formula | C21H13BrN2O3 |
|---|---|
| Molecular weight | 421.2 g/mol |
| IUPAC name | 3-(1-benzofuran-3-yl)-4-(5-bromo-1-methylindol-3-yl)pyrrole-2,5-dione |
| InChIKey | QKQJCKAXFJBYKJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC(=C2)Br)C3=C(C(=O)NC3=O)C4=COC5=CC=CC=C54 |
Computed by PubChem (NCBI)