Products 94164-88-2
CAS 94164-88-2 appears in our catalog under these names: PKM2 inhibitor (Compound 3k), PKM2-IN-1/ 99.9%, PKM2–IN–1, PKM2-IN-1, PKM2-IN-1 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(3-methyl-1,4-dioxonaphthalen-2-yl)methyl piperidine-1-carbodithioate (CAS 94164-88-2) is a chemical compound with the molecular formula C18H19NO2S2 and a molecular weight of 345.5 g/mol. IUPAC name: (3-methyl-1,4-dioxonaphthalen-2-yl)methyl piperidine-1-carbodithioate. InChIKey: STAFOGVMELKGRI-UHFFFAOYSA-N.
| Molecular formula | C18H19NO2S2 |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | (3-methyl-1,4-dioxonaphthalen-2-yl)methyl piperidine-1-carbodithioate |
| InChIKey | STAFOGVMELKGRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)CSC(=S)N3CCCCC3 |
Computed by PubChem (NCBI)