CAS 942-97-2 appears in our catalog under these names: 4–Methoxy–2–methylphenylacetic acid, 4-Methoxy-2-methylphenylacetic acid 95%, 4-Methoxy-2-methylphenylacetic acid, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-methoxy-2-methylphenyl)acetic acid (CAS 942-97-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(4-methoxy-2-methylphenyl)acetic acid. InChIKey: VYKZQEAQZIYXFI-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(4-methoxy-2-methylphenyl)acetic acid |
| InChIKey | VYKZQEAQZIYXFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)CC(=O)O |
Computed by PubChem (NCBI)