CAS 94201-85-1 is the registry number for 1-(3,4-Dichlorophenyl)-3-(3-(dimethylamino)phenyl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-dichlorophenyl)-3-[3-(dimethylamino)phenyl]urea (CAS 94201-85-1) is a chemical compound with the molecular formula C15H15Cl2N3O and a molecular weight of 324.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-[3-(dimethylamino)phenyl]urea. InChIKey: UVOLZUXECMMTLQ-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl2N3O |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-[3-(dimethylamino)phenyl]urea |
| InChIKey | UVOLZUXECMMTLQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)NC(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)