Products 942070-02-2
CAS 942070-02-2 appears in our catalog under these names: 2-(4-Bromo-5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 4-Bromo-5-chlorothiophene-2-boronic acid, pinacol ester, 98%, 4-Bromo-5-chlorothiophene-2-boronic acid, pinacol ester, 98%, 98%. Offered by: Fluorochem, Ambeed, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
2-(4-bromo-5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942070-02-2) is a chemical compound with the molecular formula C10H13BBrClO2S and a molecular weight of 323.44 g/mol. IUPAC name: 2-(4-bromo-5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HDFIJXYADDWMMB-UHFFFAOYSA-N.
| Molecular formula | C10H13BBrClO2S |
|---|---|
| Molecular weight | 323.44 g/mol |
| IUPAC name | 2-(4-bromo-5-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HDFIJXYADDWMMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(S2)Cl)Br |
Computed by PubChem (NCBI)