CAS 942206-01-1 is the registry number for 5-Bromo-2'-chloro-3,4'-bipyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-(2-chloro-4-pyridinyl)pyridine (CAS 942206-01-1) is a chemical compound with the molecular formula C10H6BrClN2 and a molecular weight of 269.52 g/mol. IUPAC name: 3-bromo-5-(2-chloro-4-pyridinyl)pyridine. InChIKey: VWSLCJBERLNLIM-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2 |
|---|---|
| Molecular weight | 269.52 g/mol |
| IUPAC name | 3-bromo-5-(2-chloro-4-pyridinyl)pyridine |
| InChIKey | VWSLCJBERLNLIM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=CC(=CN=C2)Br)Cl |
Computed by PubChem (NCBI)