CAS 94232-28-7 is the registry number for Trimethoprim L-Glutamate. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-aminopentanedioic acid;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (CAS 94232-28-7) is a chemical compound with the molecular formula C19H27N5O7 and a molecular weight of 437.4 g/mol. IUPAC name: (2S)-2-aminopentanedioic acid;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine. InChIKey: NAMYMKQHASEADQ-HVDRVSQOSA-N.
| Molecular formula | C19H27N5O7 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S)-2-aminopentanedioic acid;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| InChIKey | NAMYMKQHASEADQ-HVDRVSQOSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N.C(CC(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)