CAS 94233-19-9 is the registry number for Bis(6-methyl-2,4-heptanedionato-O,O')palladium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(6-methylheptane-2,4-dione);palladium(2+) (CAS 94233-19-9) is a chemical compound with the molecular formula C16H26O4Pd and a molecular weight of 388.8 g/mol. IUPAC name: bis(6-methylheptane-2,4-dione);palladium(2+). InChIKey: JEQLLXXOPBTFSA-UHFFFAOYSA-N.
| Molecular formula | C16H26O4Pd |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | bis(6-methylheptane-2,4-dione);palladium(2+) |
| InChIKey | JEQLLXXOPBTFSA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)[CH-]C(=O)C.CC(C)CC(=O)[CH-]C(=O)C.[Pd+2] |
Computed by PubChem (NCBI)