CAS 942400-34-2 is the registry number for (2S,6R)-4-(Azetidin-3-yl)-2,6-dimethylmorpholine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,6S)-4-(azetidin-3-yl)-2,6-dimethylmorpholine (CAS 942400-34-2) is a chemical compound with the molecular formula C9H18N2O and a molecular weight of 170.25 g/mol. IUPAC name: (2R,6S)-4-(azetidin-3-yl)-2,6-dimethylmorpholine. InChIKey: VZBSAVYBLCLTAS-OCAPTIKFSA-N.
| Molecular formula | C9H18N2O |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (2R,6S)-4-(azetidin-3-yl)-2,6-dimethylmorpholine |
| InChIKey | VZBSAVYBLCLTAS-OCAPTIKFSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2CNC2 |
Computed by PubChem (NCBI)