Products 942400-58-0
CAS 942400-58-0 is the registry number for (1S,4S)-2-Cyclopropyl-2,5-diazabicyclo(2.2.1)heptane. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,4S)-2-cyclopropyl-2,5-diazabicyclo[2.2.1]heptane (CAS 942400-58-0) is a chemical compound with the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. IUPAC name: (1S,4S)-2-cyclopropyl-2,5-diazabicyclo[2.2.1]heptane. InChIKey: GCEGIYRHAFVCGW-XPUUQOCRSA-N.
| Molecular formula | C8H14N2 |
|---|---|
| Molecular weight | 138.21 g/mol |
| IUPAC name | (1S,4S)-2-cyclopropyl-2,5-diazabicyclo[2.2.1]heptane |
| InChIKey | GCEGIYRHAFVCGW-XPUUQOCRSA-N |
| SMILES | C1CC1N2C[C@@H]3C[C@H]2CN3 |
Computed by PubChem (NCBI)