CAS 942407-05-8 is the registry number for 1,2-Bis(3,4-difluorophenyl)-1,2-ethanedione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-bis(3,4-difluorophenyl)ethane-1,2-dione (CAS 942407-05-8) is a chemical compound with the molecular formula C14H6F4O2 and a molecular weight of 282.19 g/mol. IUPAC name: 1,2-bis(3,4-difluorophenyl)ethane-1,2-dione. InChIKey: IBDJXLAQEHPROM-UHFFFAOYSA-N.
| Molecular formula | C14H6F4O2 |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | 1,2-bis(3,4-difluorophenyl)ethane-1,2-dione |
| InChIKey | IBDJXLAQEHPROM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(=O)C2=CC(=C(C=C2)F)F)F)F |
Computed by PubChem (NCBI)