CAS 942690-10-0 is the registry number for 5-Bromo-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (CAS 942690-10-0) is a chemical compound with the molecular formula C7H4BrN3OS2 and a molecular weight of 290.2 g/mol. IUPAC name: 5-bromo-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide. InChIKey: QCTLPZQYPVPXDH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3OS2 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 5-bromo-N-(1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| InChIKey | QCTLPZQYPVPXDH-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C(=O)NC2=NN=CS2 |
Computed by PubChem (NCBI)