CAS 942920-17-4 is the registry number for 4-Chloro-5-methyl-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-chloro-5-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 942920-17-4) is a chemical compound with the molecular formula C17H27ClN2Si and a molecular weight of 322.9 g/mol. IUPAC name: (4-chloro-5-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: WAROJOCZSCMOTE-UHFFFAOYSA-N.
| Molecular formula | C17H27ClN2Si |
|---|---|
| Molecular weight | 322.9 g/mol |
| IUPAC name | (4-chloro-5-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | WAROJOCZSCMOTE-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=C1Cl)C=CN2[Si](C(C)C)(C(C)C)C(C)C |
Computed by PubChem (NCBI)